C21H22FN5O3S — CID 174589615
5-(aminomethyl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine;(4-fluoro-3-nitrophenyl)-phenylmethanone (PubChem CID 174589615) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is 5-(aminomethyl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine;(4-fluoro-3-nitrophenyl)-phenylmethanone.
| Compound Name | 5-(aminomethyl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine;(4-fluoro-3-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174589615 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 5-(aminomethyl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine;(4-fluoro-3-nitrophenyl)-phenylmethanone |
| SMILES | CCNc1nc(SC)ncc1CN.O=C(c1ccccc1)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8FNO3.C8H14N4S/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9;1-3-10-7-6(4-9)5-11-8(12-7)13-2/h1-8H;5H,3-4,9H2,1-2H3,(H,10,11,12) |
| InChIKey | OWNGMHZAPCXKMG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|