C14H11F2N3O4 — CID 24903385
methyl 6-[(3,4-difluorophenyl)methylamino]-5-nitropyridine-3-carboxylate (PubChem CID 24903385) has the molecular formula C14H11F2N3O4 and a molecular weight of 323.26 g/mol. Its IUPAC name is methyl 6-[(3,4-difluorophenyl)methylamino]-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 6-[(3,4-difluorophenyl)methylamino]-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24903385 |
| Molecular Formula | C14H11F2N3O4 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | methyl 6-[(3,4-difluorophenyl)methylamino]-5-nitropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(NCc2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11F2N3O4/c1-23-14(20)9-5-12(19(21)22)13(18-7-9)17-6-8-2-3-10(15)11(16)4-8/h2-5,7H,6H2,1H3,(H,17,18) |
| InChIKey | PGNGXPZIZPGHBB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|