C13H18N4O5 — CID 24903170
methyl 6-(2-morpholin-4-ylethylamino)-5-nitropyridine-3-carboxylate (PubChem CID 24903170) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is methyl 6-(2-morpholin-4-ylethylamino)-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 6-(2-morpholin-4-ylethylamino)-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24903170 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | methyl 6-(2-morpholin-4-ylethylamino)-5-nitropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(NCCN2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N4O5/c1-21-13(18)10-8-11(17(19)20)12(15-9-10)14-2-3-16-4-6-22-7-5-16/h8-9H,2-7H2,1H3,(H,14,15) |
| InChIKey | HLRYXKZSCWWVLY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|