C14H20N2O4 — CID 163959263
methyl 3-hydroxy-5-(2-morpholin-4-ylethylamino)benzoate (PubChem CID 163959263) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 3-hydroxy-5-(2-morpholin-4-ylethylamino)benzoate.
| Compound Name | methyl 3-hydroxy-5-(2-morpholin-4-ylethylamino)benzoate |
|---|---|
| PubChem CID | 163959263 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 3-hydroxy-5-(2-morpholin-4-ylethylamino)benzoate |
| SMILES | COC(=O)c1cc(O)cc(NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-19-14(18)11-8-12(10-13(17)9-11)15-2-3-16-4-6-20-7-5-16/h8-10,15,17H,2-7H2,1H3 |
| InChIKey | SGBRHPZGIJRVMA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |