C16H23NO6 — CID 58976806
methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate (PubChem CID 58976806) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate.
| Compound Name | methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate |
|---|---|
| PubChem CID | 58976806 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate |
| SMILES | COC(=O)c1cc(OC)c(OCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C16H23NO6/c1-19-13-10-12(16(18)21-3)11-14(20-2)15(13)23-9-6-17-4-7-22-8-5-17/h10-11H,4-9H2,1-3H3 |
| InChIKey | ZWNKGPXZLCDWRP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |