methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate

C16H23NO6 — CID 58976806

IUPACmethyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate
SMILESCOC(=O)c1cc(OC)c(OCCN2CCOCC2)c(OC)c1
InChIInChI=1S/C16H23NO6/c1-19-13-10-12(16(18)21-3)11-14(20-2)15(13)23-9-6-17-4-7-22-8-5-17/h10-11H,4-9H2,1-3H3
InChIKeyZWNKGPXZLCDWRP-UHFFFAOYSA-N
MW325.36 g/mol
LogP1.20
Rot. Bonds7

About methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate

methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate (PubChem CID 58976806) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate.

Molecular Properties

Compound Namemethyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate
PubChem CID58976806
Molecular FormulaC16H23NO6
Molecular Weight325.36 g/mol
Exact Mass325.15
IUPAC Namemethyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate
SMILESCOC(=O)c1cc(OC)c(OCCN2CCOCC2)c(OC)c1
InChIInChI=1S/C16H23NO6/c1-19-13-10-12(16(18)21-3)11-14(20-2)15(13)23-9-6-17-4-7-22-8-5-17/h10-11H,4-9H2,1-3H3
InChIKeyZWNKGPXZLCDWRP-UHFFFAOYSA-N
XLogP1.20
TPSA66.46 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.36
LogP ≤ 51.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate?
The IUPAC name of methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate (CID 58976806) is methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate.
What is the SMILES notation for methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate?
The canonical SMILES for methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate is COC(=O)c1cc(OC)c(OCCN2CCOCC2)c(OC)c1.
What is the InChIKey of methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate?
The InChIKey is ZWNKGPXZLCDWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO6/c1-19-13-10-12(16(18)21-3)11-14(20-2)15(13)23-9-6-17-4-7-22-8-5-17/h10-11H,4-9H2,1-3H3.
What are the key properties of methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate?
methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate has a molecular weight of 325.36 g/mol, XLogP of 1.20, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)benzoate is sourced from PubChem (CID 58976806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).