C15H23NO5 — CID 43516741
[3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methanol (PubChem CID 43516741) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is [3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methanol.
| Compound Name | [3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 43516741 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [3,5-dimethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methanol |
| SMILES | COc1cc(CO)cc(OC)c1OCCN1CCOCC1 |
| InChI | InChI=1S/C15H23NO5/c1-18-13-9-12(11-17)10-14(19-2)15(13)21-8-5-16-3-6-20-7-4-16/h9-10,17H,3-8,11H2,1-2H3 |
| InChIKey | NCTNURVELUISOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |