C17H27NO4 — CID 20871911
4-[2-(2,3-dimethoxy-6-propan-2-ylphenoxy)ethyl]morpholine (PubChem CID 20871911) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[2-(2,3-dimethoxy-6-propan-2-ylphenoxy)ethyl]morpholine.
| Compound Name | 4-[2-(2,3-dimethoxy-6-propan-2-ylphenoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 20871911 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-[2-(2,3-dimethoxy-6-propan-2-ylphenoxy)ethyl]morpholine |
| SMILES | COc1ccc(C(C)C)c(OCCN2CCOCC2)c1OC |
| InChI | InChI=1S/C17H27NO4/c1-13(2)14-5-6-15(19-3)17(20-4)16(14)22-12-9-18-7-10-21-11-8-18/h5-6,13H,7-12H2,1-4H3 |
| InChIKey | QFYVVYATBDRKTP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |