C17H25NO6 — CID 844388
[(2R)-1-morpholin-4-ylpropan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 844388) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(2R)-1-morpholin-4-ylpropan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2R)-1-morpholin-4-ylpropan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 844388 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [(2R)-1-morpholin-4-ylpropan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@H](C)CN2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO6/c1-12(11-18-5-7-23-8-6-18)24-17(19)13-9-14(20-2)16(22-4)15(10-13)21-3/h9-10,12H,5-8,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | UJWFQGRSIXAHQU-GFCCVEGCSA-N |
| XLogP | 1.59 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |