C17H25NO5 — CID 937091
[(2S)-1-pyrrolidin-1-ylpropan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 937091) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 937091 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [(2S)-1-pyrrolidin-1-ylpropan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)CN2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO5/c1-12(11-18-7-5-6-8-18)23-17(19)13-9-14(20-2)16(22-4)15(10-13)21-3/h9-10,12H,5-8,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | MXLXLDMDPYBBDH-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |