C16H24N2O4 — CID 166767320
N-ethyl-3-methoxy-4-(2-morpholin-4-ylethoxy)benzamide (PubChem CID 166767320) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-ethyl-3-methoxy-4-(2-morpholin-4-ylethoxy)benzamide.
| Compound Name | N-ethyl-3-methoxy-4-(2-morpholin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 166767320 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-ethyl-3-methoxy-4-(2-morpholin-4-ylethoxy)benzamide |
| SMILES | CCNC(=O)c1ccc(OCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-3-17-16(19)13-4-5-14(15(12-13)20-2)22-11-8-18-6-9-21-10-7-18/h4-5,12H,3,6-11H2,1-2H3,(H,17,19) |
| InChIKey | JNSQTJKUASMNCM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |