C15H22N4O4 — CID 168532539
[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]urea (PubChem CID 168532539) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is [[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]urea.
| Compound Name | [[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532539 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]urea |
| SMILES | COc1cc(C=NNC(N)=O)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C15H22N4O4/c1-21-14-10-12(11-17-18-15(16)20)2-3-13(14)23-9-6-19-4-7-22-8-5-19/h2-3,10-11H,4-9H2,1H3,(H3,16,18,20) |
| InChIKey | FFWXSRFQQCMANP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|