C23H29N3O4S — CID 5431219
N-[(Z)-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5431219) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(Z)-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5431219 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2csc3c2CCCC3)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C23H29N3O4S/c1-28-21-14-17(6-7-20(21)30-13-10-26-8-11-29-12-9-26)15-24-25-23(27)19-16-31-22-5-3-2-4-18(19)22/h6-7,14-16H,2-5,8-13H2,1H3,(H,25,27)/b24-15- |
| InChIKey | BXTDPOVPPWCYJX-IWIPYMOSSA-N |
| XLogP | 3.11 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|