C26H29N3O4 — CID 5430547
3-hydroxy-N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide (PubChem CID 5430547) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-hydroxy-N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5430547 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-hydroxy-N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3ccccc3cc2O)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C26H29N3O4/c1-32-25-15-19(9-10-24(25)33-14-13-29-11-5-2-6-12-29)18-27-28-26(31)22-16-20-7-3-4-8-21(20)17-23(22)30/h3-4,7-10,15-18,30H,2,5-6,11-14H2,1H3,(H,28,31)/b27-18- |
| InChIKey | NPYRKPWGQDDCRN-IMRQLAEWSA-N |
| XLogP | 4.18 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|