C21H26N4O3 — CID 5430549
N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 5430549) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 5430549 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[(Z)-[3-methoxy-4-(2-piperidin-1-ylethoxy)phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccncc2)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C21H26N4O3/c1-27-20-15-17(16-23-24-21(26)18-7-9-22-10-8-18)5-6-19(20)28-14-13-25-11-3-2-4-12-25/h5-10,15-16H,2-4,11-14H2,1H3,(H,24,26)/b23-16- |
| InChIKey | KZGINLIOXMLRJL-KQWNVCNZSA-N |
| XLogP | 2.72 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|