C20H25N3O3 — CID 169382491
N-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]aniline (PubChem CID 169382491) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]aniline.
| Compound Name | N-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169382491 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylideneamino]aniline |
| SMILES | COc1cc(C=NNc2ccccc2)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C20H25N3O3/c1-24-20-15-17(16-21-22-18-5-3-2-4-6-18)7-8-19(20)26-14-11-23-9-12-25-13-10-23/h2-8,15-16,22H,9-14H2,1H3 |
| InChIKey | PEUMFCKDYDGCFJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|