C21H26N2O4 — CID 90211616
methyl 3-(2-morpholin-4-ylethylamino)-4-phenylmethoxybenzoate (PubChem CID 90211616) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 3-(2-morpholin-4-ylethylamino)-4-phenylmethoxybenzoate.
| Compound Name | methyl 3-(2-morpholin-4-ylethylamino)-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 90211616 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl 3-(2-morpholin-4-ylethylamino)-4-phenylmethoxybenzoate |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)c(NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-25-21(24)18-7-8-20(27-16-17-5-3-2-4-6-17)19(15-18)22-9-10-23-11-13-26-14-12-23/h2-8,15,22H,9-14,16H2,1H3 |
| InChIKey | MDQSONIWMUPAHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |