C27H30N2O5 — CID 141436173
4-methoxy-N-[4-(2-morpholin-4-ylethoxy)phenyl]-3-phenylmethoxybenzamide (PubChem CID 141436173) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-methoxy-N-[4-(2-morpholin-4-ylethoxy)phenyl]-3-phenylmethoxybenzamide.
| Compound Name | 4-methoxy-N-[4-(2-morpholin-4-ylethoxy)phenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 141436173 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-methoxy-N-[4-(2-morpholin-4-ylethoxy)phenyl]-3-phenylmethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(OCCN3CCOCC3)cc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O5/c1-31-25-12-7-22(19-26(25)34-20-21-5-3-2-4-6-21)27(30)28-23-8-10-24(11-9-23)33-18-15-29-13-16-32-17-14-29/h2-12,19H,13-18,20H2,1H3,(H,28,30) |
| InChIKey | IIXSUXUWOCSNIT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |