C35H38N2O4 — CID 135336988
N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide (PubChem CID 135336988) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide.
| Compound Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 135336988 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1cc(C(=O)Nc2ccc(CN3CCOCC3)cc2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H38N2O4/c1-26(2)31-21-32(35(38)36-30-15-13-27(14-16-30)23-37-17-19-39-20-18-37)34(41-25-29-11-7-4-8-12-29)22-33(31)40-24-28-9-5-3-6-10-28/h3-16,21-22,26H,17-20,23-25H2,1-2H3,(H,36,38) |
| InChIKey | ILAIHIKNNRMVOO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |