C33H32N2O3 — CID 146316537
N-(1-methylindol-7-yl)-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide (PubChem CID 146316537) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-(1-methylindol-7-yl)-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide.
| Compound Name | N-(1-methylindol-7-yl)-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 146316537 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-(1-methylindol-7-yl)-2,4-bis(phenylmethoxy)-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1cc(C(=O)Nc2cccc3ccn(C)c23)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C33H32N2O3/c1-23(2)27-19-28(33(36)34-29-16-10-15-26-17-18-35(3)32(26)29)31(38-22-25-13-8-5-9-14-25)20-30(27)37-21-24-11-6-4-7-12-24/h4-20,23H,21-22H2,1-3H3,(H,34,36) |
| InChIKey | CNXCABRZIFXHGO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |