C38H42N2O3SSi — CID 59829923
N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarbothioamide (PubChem CID 59829923) has the molecular formula C38H42N2O3SSi and a molecular weight of 634.92 g/mol. Its IUPAC name is N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarbothioamide.
| Compound Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 59829923 |
| Molecular Formula | C38H42N2O3SSi |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarbothioamide |
| SMILES | C[Si](C)(C)C#CCc1cc(C(=S)Nc2ccc(CN3CCOCC3)cc2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C38H42N2O3SSi/c1-45(2,3)24-10-15-33-25-35(38(44)39-34-18-16-30(17-19-34)27-40-20-22-41-23-21-40)37(43-29-32-13-8-5-9-14-32)26-36(33)42-28-31-11-6-4-7-12-31/h4-9,11-14,16-19,25-26H,15,20-23,27-29H2,1-3H3,(H,39,44) |
| InChIKey | RLEYOHWTGIYVMO-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|