C15H14ClN5O4S — CID 35572796
5-chloro-N'-(2-nitrobenzoyl)-2-propylsulfanylpyrimidine-4-carbohydrazide (PubChem CID 35572796) has the molecular formula C15H14ClN5O4S and a molecular weight of 395.83 g/mol. Its IUPAC name is 5-chloro-N'-(2-nitrobenzoyl)-2-propylsulfanylpyrimidine-4-carbohydrazide.
| Compound Name | 5-chloro-N'-(2-nitrobenzoyl)-2-propylsulfanylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 35572796 |
| Molecular Formula | C15H14ClN5O4S |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 5-chloro-N'-(2-nitrobenzoyl)-2-propylsulfanylpyrimidine-4-carbohydrazide |
| SMILES | CCCSc1ncc(Cl)c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H14ClN5O4S/c1-2-7-26-15-17-8-10(16)12(18-15)14(23)20-19-13(22)9-5-3-4-6-11(9)21(24)25/h3-6,8H,2,7H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | CUIYOKFEDJQLMG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|