C13H17ClN2O3 — CID 114304453
N-[3-(chloromethyl)pentan-3-yl]-2-nitrobenzamide (PubChem CID 114304453) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is N-[3-(chloromethyl)pentan-3-yl]-2-nitrobenzamide.
| Compound Name | N-[3-(chloromethyl)pentan-3-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 114304453 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[3-(chloromethyl)pentan-3-yl]-2-nitrobenzamide |
| SMILES | CCC(CC)(CCl)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17ClN2O3/c1-3-13(4-2,9-14)15-12(17)10-7-5-6-8-11(10)16(18)19/h5-8H,3-4,9H2,1-2H3,(H,15,17) |
| InChIKey | OUZDNXZSESNURP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|