C12H13Cl3N2O3 — CID 107867433
2-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-nitrobenzamide (PubChem CID 107867433) has the molecular formula C12H13Cl3N2O3 and a molecular weight of 339.61 g/mol. Its IUPAC name is 2-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-nitrobenzamide |
|---|---|
| PubChem CID | 107867433 |
| Molecular Formula | C12H13Cl3N2O3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-nitrobenzamide |
| SMILES | CCC(CCl)(CCl)NC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13Cl3N2O3/c1-2-12(6-13,7-14)16-11(18)10-8(15)4-3-5-9(10)17(19)20/h3-5H,2,6-7H2,1H3,(H,16,18) |
| InChIKey | LDLNBXJWSSXRDL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|