C14H18Cl2N2O3 — CID 106355847
2-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-6-nitrobenzamide (PubChem CID 106355847) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-6-nitrobenzamide.
| Compound Name | 2-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-6-nitrobenzamide |
|---|---|
| PubChem CID | 106355847 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-chloro-N-(1-chloro-4,4-dimethylpentan-3-yl)-6-nitrobenzamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-14(2,3)11(7-8-15)17-13(19)12-9(16)5-4-6-10(12)18(20)21/h4-6,11H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | GYUJAZXHOWUZOC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|