C11H11ClN2O3 — CID 114618707
2-chloro-N-(2-methylprop-2-enyl)-6-nitrobenzamide (PubChem CID 114618707) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 2-chloro-N-(2-methylprop-2-enyl)-6-nitrobenzamide.
| Compound Name | 2-chloro-N-(2-methylprop-2-enyl)-6-nitrobenzamide |
|---|---|
| PubChem CID | 114618707 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-chloro-N-(2-methylprop-2-enyl)-6-nitrobenzamide |
| SMILES | C=C(C)CNC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN2O3/c1-7(2)6-13-11(15)10-8(12)4-3-5-9(10)14(16)17/h3-5H,1,6H2,2H3,(H,13,15) |
| InChIKey | MWYZMYCDGYVRAL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|