C14H16ClN3O6 — CID 119173026
4-[[2-[(2-chloro-6-nitrobenzoyl)amino]acetyl]-methylamino]butanoic acid (PubChem CID 119173026) has the molecular formula C14H16ClN3O6 and a molecular weight of 357.75 g/mol. Its IUPAC name is 4-[[2-[(2-chloro-6-nitrobenzoyl)amino]acetyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-[(2-chloro-6-nitrobenzoyl)amino]acetyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119173026 |
| Molecular Formula | C14H16ClN3O6 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-[[2-[(2-chloro-6-nitrobenzoyl)amino]acetyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)CNC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16ClN3O6/c1-17(7-3-6-12(20)21)11(19)8-16-14(22)13-9(15)4-2-5-10(13)18(23)24/h2,4-5H,3,6-8H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | TUDOWPCESULUGK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|