C13H15ClN2O5 — CID 64579541
ethyl 4-[(2-chloro-6-nitrobenzoyl)amino]butanoate (PubChem CID 64579541) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.73 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-6-nitrobenzoyl)amino]butanoate.
| Compound Name | ethyl 4-[(2-chloro-6-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 64579541 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl 4-[(2-chloro-6-nitrobenzoyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN2O5/c1-2-21-11(17)7-4-8-15-13(18)12-9(14)5-3-6-10(12)16(19)20/h3,5-6H,2,4,7-8H2,1H3,(H,15,18) |
| InChIKey | UYMZWRADWWZMDE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|