C13H15ClN6O2S — CID 122671934
6-chloro-N-[(2-methylpyrimidin-5-yl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine (PubChem CID 122671934) has the molecular formula C13H15ClN6O2S and a molecular weight of 354.82 g/mol. Its IUPAC name is 6-chloro-N-[(2-methylpyrimidin-5-yl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(2-methylpyrimidin-5-yl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122671934 |
| Molecular Formula | C13H15ClN6O2S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 6-chloro-N-[(2-methylpyrimidin-5-yl)methyl]-5-nitro-2-propylsulfanylpyrimidin-4-amine |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(NCc2cnc(C)nc2)n1 |
| InChI | InChI=1S/C13H15ClN6O2S/c1-3-4-23-13-18-11(14)10(20(21)22)12(19-13)17-7-9-5-15-8(2)16-6-9/h5-6H,3-4,7H2,1-2H3,(H,17,18,19) |
| InChIKey | FXCLRQAKICJUSM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|