C15H9ClF2N4O2 — CID 10981027
7-chloro-N-[(3,4-difluorophenyl)methyl]-6-nitroquinazolin-4-amine (PubChem CID 10981027) has the molecular formula C15H9ClF2N4O2 and a molecular weight of 350.71 g/mol. Its IUPAC name is 7-chloro-N-[(3,4-difluorophenyl)methyl]-6-nitroquinazolin-4-amine.
| Compound Name | 7-chloro-N-[(3,4-difluorophenyl)methyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 10981027 |
| Molecular Formula | C15H9ClF2N4O2 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 7-chloro-N-[(3,4-difluorophenyl)methyl]-6-nitroquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(NCc3ccc(F)c(F)c3)ncnc2cc1Cl |
| InChI | InChI=1S/C15H9ClF2N4O2/c16-10-5-13-9(4-14(10)22(23)24)15(21-7-20-13)19-6-8-1-2-11(17)12(18)3-8/h1-5,7H,6H2,(H,19,20,21) |
| InChIKey | VOUFQLQIDZSRCJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|