C16H22Cl2N6O2S2 — CID 163203070
4-[2-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)oxyethoxy]-6-chloro-2-propylsulfanylpyrimidin-5-amine (PubChem CID 163203070) has the molecular formula C16H22Cl2N6O2S2 and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[2-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)oxyethoxy]-6-chloro-2-propylsulfanylpyrimidin-5-amine.
| Compound Name | 4-[2-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)oxyethoxy]-6-chloro-2-propylsulfanylpyrimidin-5-amine |
|---|---|
| PubChem CID | 163203070 |
| Molecular Formula | C16H22Cl2N6O2S2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[2-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)oxyethoxy]-6-chloro-2-propylsulfanylpyrimidin-5-amine |
| SMILES | CCCSc1nc(Cl)c(N)c(OCCOc2nc(SCCC)nc(Cl)c2N)n1 |
| InChI | InChI=1S/C16H22Cl2N6O2S2/c1-3-7-27-15-21-11(17)9(19)13(23-15)25-5-6-26-14-10(20)12(18)22-16(24-14)28-8-4-2/h3-8,19-20H2,1-2H3 |
| InChIKey | UMMYRRGGFDZNLY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|