C8H12ClN5 — CID 3132066
6-chloro-2-N,2-N-dimethyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 3132066) has the molecular formula C8H12ClN5 and a molecular weight of 213.67 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-dimethyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-dimethyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3132066 |
| Molecular Formula | C8H12ClN5 |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 6-chloro-2-N,2-N-dimethyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C8H12ClN5/c1-4-5-10-7-11-6(9)12-8(13-7)14(2)3/h4H,1,5H2,2-3H3,(H,10,11,12,13) |
| InChIKey | NEKXSUWNKQLIRQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|