C9H14ClN5 — CID 106195710
4-N-but-3-en-2-yl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 106195710) has the molecular formula C9H14ClN5 and a molecular weight of 227.70 g/mol. Its IUPAC name is 4-N-but-3-en-2-yl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-but-3-en-2-yl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106195710 |
| Molecular Formula | C9H14ClN5 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-N-but-3-en-2-yl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CC(C)Nc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H14ClN5/c1-5-6(2)11-8-12-7(10)13-9(14-8)15(3)4/h5-6H,1H2,2-4H3,(H,11,12,13,14) |
| InChIKey | JAEOYWDJMHLNCZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|