About 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine
2-chloro-N,9-bis(prop-2-enyl)purin-6-amine (PubChem CID 10490871) has the molecular formula C11H12ClN5
and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine.
Molecular Properties
| Compound Name | 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine |
| PubChem CID | 10490871 |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine |
| SMILES | C=CCNc1nc(Cl)nc2c1ncn2CC=C |
| InChI | InChI=1S/C11H12ClN5/c1-3-5-13-9-8-10(16-11(12)15-9)17(6-4-2)7-14-8/h3-4,7H,1-2,5-6H2,(H,13,15,16) |
| InChIKey | HTLKAEBCRRUTGN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine?
The IUPAC name of 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine (CID 10490871) is 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine.
What is the SMILES notation for 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine?
The canonical SMILES for 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine is C=CCNc1nc(Cl)nc2c1ncn2CC=C.
What is the InChIKey of 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine?
The InChIKey is HTLKAEBCRRUTGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5/c1-3-5-13-9-8-10(16-11(12)15-9)17(6-4-2)7-14-8/h3-4,7H,1-2,5-6H2,(H,13,15,16).
What are the key properties of 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine?
2-chloro-N,9-bis(prop-2-enyl)purin-6-amine has a molecular weight of 249.70 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,9-bis(prop-2-enyl)purin-6-amine is sourced from PubChem (CID 10490871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).