C27H29N7O — CID 23907939
[4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone (PubChem CID 23907939) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is [4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 23907939 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | [4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone |
| SMILES | C=CCNc1nc(N2CCN(C(=O)c3ccc(C)cc3)CC2)nc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C27H29N7O/c1-3-13-28-24-23-25(34(19-29-23)18-21-7-5-4-6-8-21)31-27(30-24)33-16-14-32(15-17-33)26(35)22-11-9-20(2)10-12-22/h3-12,19H,1,13-18H2,2H3,(H,28,30,31) |
| InChIKey | LDMUQCNLKWXDNQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|