C31H30ClN9O3 — CID 23740320
4-[6-[(2-chlorophenyl)methylamino]-9-[(4-nitrophenyl)methyl]purin-2-yl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 23740320) has the molecular formula C31H30ClN9O3 and a molecular weight of 612.09 g/mol. Its IUPAC name is 4-[6-[(2-chlorophenyl)methylamino]-9-[(4-nitrophenyl)methyl]purin-2-yl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-[(2-chlorophenyl)methylamino]-9-[(4-nitrophenyl)methyl]purin-2-yl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23740320 |
| Molecular Formula | C31H30ClN9O3 |
| Molecular Weight | 612.09 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | 4-[6-[(2-chlorophenyl)methylamino]-9-[(4-nitrophenyl)methyl]purin-2-yl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3nc(NCc4ccccc4Cl)c4ncn(Cc5ccc([N+](=O)[O-])cc5)c4n3)CC2)cc1 |
| InChI | InChI=1S/C31H30ClN9O3/c1-21-6-10-24(11-7-21)35-31(42)39-16-14-38(15-17-39)30-36-28(33-18-23-4-2-3-5-26(23)32)27-29(37-30)40(20-34-27)19-22-8-12-25(13-9-22)41(43)44/h2-13,20H,14-19H2,1H3,(H,35,42)(H,33,36,37) |
| InChIKey | NZMPWJMQWDAIRV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.09 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|