C26H27N9O3 — CID 23964231
4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 23964231) has the molecular formula C26H27N9O3 and a molecular weight of 513.56 g/mol. Its IUPAC name is 4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23964231 |
| Molecular Formula | C26H27N9O3 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[9-benzyl-6-(prop-2-enylamino)purin-2-yl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | C=CCNc1nc(N2CCN(C(=O)Nc3ccc([N+](=O)[O-])cc3)CC2)nc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C26H27N9O3/c1-2-12-27-23-22-24(34(18-28-22)17-19-6-4-3-5-7-19)31-25(30-23)32-13-15-33(16-14-32)26(36)29-20-8-10-21(11-9-20)35(37)38/h2-11,18H,1,12-17H2,(H,29,36)(H,27,30,31) |
| InChIKey | VGUANXZFDDYBIH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|