C25H29N7O4 — CID 66799390
2-[[[9-benzyl-2-[(2-hydroxy-2-methylpentan-3-yl)amino]purin-6-yl]amino]methyl]-4-nitrophenol (PubChem CID 66799390) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-[[[9-benzyl-2-[(2-hydroxy-2-methylpentan-3-yl)amino]purin-6-yl]amino]methyl]-4-nitrophenol.
| Compound Name | 2-[[[9-benzyl-2-[(2-hydroxy-2-methylpentan-3-yl)amino]purin-6-yl]amino]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 66799390 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 2-[[[9-benzyl-2-[(2-hydroxy-2-methylpentan-3-yl)amino]purin-6-yl]amino]methyl]-4-nitrophenol |
| SMILES | CCC(Nc1nc(NCc2cc([N+](=O)[O-])ccc2O)c2ncn(Cc3ccccc3)c2n1)C(C)(C)O |
| InChI | InChI=1S/C25H29N7O4/c1-4-20(25(2,3)34)28-24-29-22(26-13-17-12-18(32(35)36)10-11-19(17)33)21-23(30-24)31(15-27-21)14-16-8-6-5-7-9-16/h5-12,15,20,33-34H,4,13-14H2,1-3H3,(H2,26,28,29,30) |
| InChIKey | DKZSYXPKGNYZJN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|