C14H22N2O3 — CID 58581757
2-[[[(3R)-2,2-dimethylpentan-3-yl]amino]methyl]-4-nitrophenol (PubChem CID 58581757) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[[[(3R)-2,2-dimethylpentan-3-yl]amino]methyl]-4-nitrophenol.
| Compound Name | 2-[[[(3R)-2,2-dimethylpentan-3-yl]amino]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 58581757 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[[[(3R)-2,2-dimethylpentan-3-yl]amino]methyl]-4-nitrophenol |
| SMILES | CC[C@@H](NCc1cc([N+](=O)[O-])ccc1O)C(C)(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-5-13(14(2,3)4)15-9-10-8-11(16(18)19)6-7-12(10)17/h6-8,13,15,17H,5,9H2,1-4H3/t13-/m1/s1 |
| InChIKey | XTIXKLWZCSPYKD-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|