C23H29N3O5 — CID 9155055
4-tert-butyl-N-[(2S)-1-[(2-hydroxy-5-nitrophenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 9155055) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2S)-1-[(2-hydroxy-5-nitrophenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2S)-1-[(2-hydroxy-5-nitrophenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9155055 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-tert-butyl-N-[(2S)-1-[(2-hydroxy-5-nitrophenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C23H29N3O5/c1-14(2)20(25-21(28)15-6-8-17(9-7-15)23(3,4)5)22(29)24-13-16-12-18(26(30)31)10-11-19(16)27/h6-12,14,20,27H,13H2,1-5H3,(H,24,29)(H,25,28)/t20-/m0/s1 |
| InChIKey | JSEDDOXLRTWFKH-FQEVSTJZSA-N |
| XLogP | 3.67 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|