About 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane
2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane (PubChem CID 157342719) has the molecular formula C17H24N2O7
and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane.
Molecular Properties
| Compound Name | 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane |
| PubChem CID | 157342719 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane |
| SMILES | C.C.CCc1cc([N+](=O)[O-])ccc1O.O=[N+]([O-])c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C8H9NO3.C7H7NO4.2CH4/c1-2-6-5-7(9(11)12)3-4-8(6)10;9-4-5-3-6(8(11)12)1-2-7(5)10;;/h3-5,10H,2H2,1H3;1-3,9-10H,4H2;2*1H4 |
| InChIKey | BGOYZAUEELBYRR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane?
The IUPAC name of 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane (CID 157342719) is 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane.
What is the SMILES notation for 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane?
The canonical SMILES for 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane is C.C.CCc1cc([N+](=O)[O-])ccc1O.O=[N+]([O-])c1ccc(O)c(CO)c1.
What is the InChIKey of 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane?
The InChIKey is BGOYZAUEELBYRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.C7H7NO4.2CH4/c1-2-6-5-7(9(11)12)3-4-8(6)10;9-4-5-3-6(8(11)12)1-2-7(5)10;;/h3-5,10H,2H2,1H3;1-3,9-10H,4H2;2*1H4.
What are the key properties of 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane?
2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane has a molecular weight of 368.39 g/mol, XLogP of 3.93, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-nitrophenol;2-(hydroxymethyl)-4-nitrophenol;methane is sourced from PubChem (CID 157342719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).