About 2-amino-4-nitrophenol;ethanol
2-amino-4-nitrophenol;ethanol (PubChem CID 174857010) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-amino-4-nitrophenol;ethanol.
Molecular Properties
| Compound Name | 2-amino-4-nitrophenol;ethanol |
| PubChem CID | 174857010 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-amino-4-nitrophenol;ethanol |
| SMILES | CCO.Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C6H6N2O3.C2H6O/c7-5-3-4(8(10)11)1-2-6(5)9;1-2-3/h1-3,9H,7H2;3H,2H2,1H3 |
| InChIKey | CNWNAZTYXRXFLF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-nitrophenol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-nitrophenol;ethanol?
The IUPAC name of 2-amino-4-nitrophenol;ethanol (CID 174857010) is 2-amino-4-nitrophenol;ethanol.
What is the SMILES notation for 2-amino-4-nitrophenol;ethanol?
The canonical SMILES for 2-amino-4-nitrophenol;ethanol is CCO.Nc1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of 2-amino-4-nitrophenol;ethanol?
The InChIKey is CNWNAZTYXRXFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3.C2H6O/c7-5-3-4(8(10)11)1-2-6(5)9;1-2-3/h1-3,9H,7H2;3H,2H2,1H3.
What are the key properties of 2-amino-4-nitrophenol;ethanol?
2-amino-4-nitrophenol;ethanol has a molecular weight of 200.19 g/mol, XLogP of 0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-nitrophenol;ethanol is sourced from PubChem (CID 174857010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).