About 2-amino-4-nitrophenol;1H-pyrazole
2-amino-4-nitrophenol;1H-pyrazole (PubChem CID 174791393) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-amino-4-nitrophenol;1H-pyrazole.
Molecular Properties
| Compound Name | 2-amino-4-nitrophenol;1H-pyrazole |
| PubChem CID | 174791393 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-amino-4-nitrophenol;1H-pyrazole |
| SMILES | Nc1cc([N+](=O)[O-])ccc1O.c1cn[nH]c1 |
| InChI | InChI=1S/C6H6N2O3.C3H4N2/c7-5-3-4(8(10)11)1-2-6(5)9;1-2-4-5-3-1/h1-3,9H,7H2;1-3H,(H,4,5) |
| InChIKey | JGUVEZMSZZNPEL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-nitrophenol;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-nitrophenol;1H-pyrazole?
The IUPAC name of 2-amino-4-nitrophenol;1H-pyrazole (CID 174791393) is 2-amino-4-nitrophenol;1H-pyrazole.
What is the SMILES notation for 2-amino-4-nitrophenol;1H-pyrazole?
The canonical SMILES for 2-amino-4-nitrophenol;1H-pyrazole is Nc1cc([N+](=O)[O-])ccc1O.c1cn[nH]c1.
What is the InChIKey of 2-amino-4-nitrophenol;1H-pyrazole?
The InChIKey is JGUVEZMSZZNPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3.C3H4N2/c7-5-3-4(8(10)11)1-2-6(5)9;1-2-4-5-3-1/h1-3,9H,7H2;1-3H,(H,4,5).
What are the key properties of 2-amino-4-nitrophenol;1H-pyrazole?
2-amino-4-nitrophenol;1H-pyrazole has a molecular weight of 222.20 g/mol, XLogP of 1.29, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-nitrophenol;1H-pyrazole is sourced from PubChem (CID 174791393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).