C7H6N6O5 — CID 154637642
2,4-dinitrophenol;2H-tetrazole (PubChem CID 154637642) has the molecular formula C7H6N6O5 and a molecular weight of 254.16 g/mol. Its IUPAC name is 2,4-dinitrophenol;2H-tetrazole.
| Compound Name | 2,4-dinitrophenol;2H-tetrazole |
|---|---|
| PubChem CID | 154637642 |
| Molecular Formula | C7H6N6O5 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2,4-dinitrophenol;2H-tetrazole |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1.c1nn[nH]n1 |
| InChI | InChI=1S/C6H4N2O5.CH2N4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;1-2-4-5-3-1/h1-3,9H;1H,(H,2,3,4,5) |
| InChIKey | IQKASOXHVWSOOL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|