C8H6N4O3 — CID 137048656
4-nitro-2-(1H-1,2,4-triazol-5-yl)phenol (PubChem CID 137048656) has the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. Its IUPAC name is 4-nitro-2-(1H-1,2,4-triazol-5-yl)phenol.
| Compound Name | 4-nitro-2-(1H-1,2,4-triazol-5-yl)phenol |
|---|---|
| PubChem CID | 137048656 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 4-nitro-2-(1H-1,2,4-triazol-5-yl)phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H6N4O3/c13-7-2-1-5(12(14)15)3-6(7)8-9-4-10-11-8/h1-4,13H,(H,9,10,11) |
| InChIKey | DCURKCBKMLSOQO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|