C10H8F3N3O4 — CID 136677516
(5R)-3-(2-hydroxy-5-nitrophenyl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol (PubChem CID 136677516) has the molecular formula C10H8F3N3O4 and a molecular weight of 291.19 g/mol. Its IUPAC name is (5R)-3-(2-hydroxy-5-nitrophenyl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol.
| Compound Name | (5R)-3-(2-hydroxy-5-nitrophenyl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol |
|---|---|
| PubChem CID | 136677516 |
| Molecular Formula | C10H8F3N3O4 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (5R)-3-(2-hydroxy-5-nitrophenyl)-5-(trifluoromethyl)-1,4-dihydropyrazol-5-ol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C2=NN[C@](O)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C10H8F3N3O4/c11-10(12,13)9(18)4-7(14-15-9)6-3-5(16(19)20)1-2-8(6)17/h1-3,15,17-18H,4H2/t9-/m1/s1 |
| InChIKey | DANMCXZURXWMHB-SECBINFHSA-N |
| XLogP | 1.25 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|