C9H7N5O4 — CID 103894307
N-(2-hydroxy-5-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 103894307) has the molecular formula C9H7N5O4 and a molecular weight of 249.19 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 103894307 |
| Molecular Formula | C9H7N5O4 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)c1ncn[nH]1 |
| InChI | InChI=1S/C9H7N5O4/c15-7-2-1-5(14(17)18)3-6(7)12-9(16)8-10-4-11-13-8/h1-4,15H,(H,12,16)(H,10,11,13) |
| InChIKey | ZKQIHSKCHWSUKU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|