C10H6ClN5O6 — CID 135803794
4-chloro-N-(2-hydroxy-5-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803794) has the molecular formula C10H6ClN5O6 and a molecular weight of 327.64 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxy-5-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-(2-hydroxy-5-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803794 |
| Molecular Formula | C10H6ClN5O6 |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 4-chloro-N-(2-hydroxy-5-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C10H6ClN5O6/c11-7-8(13-14-9(7)16(21)22)10(18)12-5-3-4(15(19)20)1-2-6(5)17/h1-3,17H,(H,12,18)(H,13,14) |
| InChIKey | FVOCNAQOIIPNLX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 164.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|