C13H12ClN5O7 — CID 135803714
4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803714) has the molecular formula C13H12ClN5O7 and a molecular weight of 385.72 g/mol. Its IUPAC name is 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803714 |
| Molecular Formula | C13H12ClN5O7 |
| Molecular Weight | 385.72 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C13H12ClN5O7/c14-9-10(16-17-12(9)19(25)26)13(22)15-8(5-20)11(21)6-1-3-7(4-2-6)18(23)24/h1-4,8,11,20-21H,5H2,(H,15,22)(H,16,17) |
| InChIKey | CDBURTJLFPEEBP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.72 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|