C13H13ClN4O5 — CID 19479404
4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1H-pyrazole-5-carboxamide (PubChem CID 19479404) has the molecular formula C13H13ClN4O5 and a molecular weight of 340.72 g/mol. Its IUPAC name is 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479404 |
| Molecular Formula | C13H13ClN4O5 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-chloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1[nH]ncc1Cl |
| InChI | InChI=1S/C13H13ClN4O5/c14-9-5-15-17-11(9)13(21)16-10(6-19)12(20)7-1-3-8(4-2-7)18(22)23/h1-5,10,12,19-20H,6H2,(H,15,17)(H,16,21) |
| InChIKey | JUEAYQFGPOVRQM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|