C20H29N7O — CID 67002939
3-[[6-[(2-amino-5-methylphenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol (PubChem CID 67002939) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-methylphenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-methylphenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 67002939 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 3-[[6-[(2-amino-5-methylphenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(C)ccc2N)c2ncn(C)c2n1)C(C)(C)O |
| InChI | InChI=1S/C20H29N7O/c1-6-15(20(3,4)28)24-19-25-17(16-18(26-19)27(5)11-23-16)22-10-13-9-12(2)7-8-14(13)21/h7-9,11,15,28H,6,10,21H2,1-5H3,(H2,22,24,25,26) |
| InChIKey | WKOAESIQWWJQRE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|